About 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione
8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 70456430) has the molecular formula C11H15ClN4O2
and a molecular weight of 270.72 g/mol. Its IUPAC name is 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 70456430 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CCCC(Cl)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H15ClN4O2/c1-4-5-6(12)8-13-7-9(14-8)15(2)11(18)16(3)10(7)17/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | SMKCXLCVFRHJQY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione (CID 70456430) is 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione is CCCC(Cl)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C.
What is the InChIKey of 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is SMKCXLCVFRHJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN4O2/c1-4-5-6(12)8-13-7-9(14-8)15(2)11(18)16(3)10(7)17/h6H,4-5H2,1-3H3,(H,13,14).
What are the key properties of 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione?
8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 270.72 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 70456430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).