C11H15ClN4O2 — CID 70456430
8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 70456430) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 70456430 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 8-(1-chlorobutyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CCCC(Cl)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H15ClN4O2/c1-4-5-6(12)8-13-7-9(14-8)15(2)11(18)16(3)10(7)17/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | SMKCXLCVFRHJQY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|