C16H22N4O2 — CID 5461877
8-(dicyclopropylmethyl)-1-(111C)methyl-3-propyl-7H-purine-2,6-dione (PubChem CID 5461877) has the molecular formula C16H22N4O2 and a molecular weight of 301.38 g/mol. Its IUPAC name is 8-(dicyclopropylmethyl)-1-(111C)methyl-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-(dicyclopropylmethyl)-1-(111C)methyl-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 5461877 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 8-(dicyclopropylmethyl)-1-(111C)methyl-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)n([11CH3])c(=O)c2[nH]c(C(C3CC3)C3CC3)nc21 |
| InChI | InChI=1S/C16H22N4O2/c1-3-8-20-14-12(15(21)19(2)16(20)22)17-13(18-14)11(9-4-5-9)10-6-7-10/h9-11H,3-8H2,1-2H3,(H,17,18)/i2-1 |
| InChIKey | RGDOXQAJXVTNRP-JVVVGQRLSA-N |
| XLogP | 1.74 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |