C17H24N4O2 — CID 11723303
8-(dicyclopropylmethyl)-1,7-dimethyl-3-propylpurine-2,6-dione (PubChem CID 11723303) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 8-(dicyclopropylmethyl)-1,7-dimethyl-3-propylpurine-2,6-dione.
| Compound Name | 8-(dicyclopropylmethyl)-1,7-dimethyl-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 11723303 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 8-(dicyclopropylmethyl)-1,7-dimethyl-3-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)n(C)c(=O)c2c1nc(C(C1CC1)C1CC1)n2C |
| InChI | InChI=1S/C17H24N4O2/c1-4-9-21-15-13(16(22)20(3)17(21)23)19(2)14(18-15)12(10-5-6-10)11-7-8-11/h10-12H,4-9H2,1-3H3 |
| InChIKey | OFNQWUMXLWQBRC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |