C20H30N4O2 — CID 15667115
8-(dicyclopropylmethyl)-7-ethyl-1,3-dipropylpurine-2,6-dione (PubChem CID 15667115) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 8-(dicyclopropylmethyl)-7-ethyl-1,3-dipropylpurine-2,6-dione.
| Compound Name | 8-(dicyclopropylmethyl)-7-ethyl-1,3-dipropylpurine-2,6-dione |
|---|---|
| PubChem CID | 15667115 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 8-(dicyclopropylmethyl)-7-ethyl-1,3-dipropylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(C(C3CC3)C3CC3)n2CC)n(CCC)c1=O |
| InChI | InChI=1S/C20H30N4O2/c1-4-11-23-18-16(19(25)24(12-5-2)20(23)26)22(6-3)17(21-18)15(13-7-8-13)14-9-10-14/h13-15H,4-12H2,1-3H3 |
| InChIKey | HXWAWQNTQZSAJM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |