C14H20BrClN4O2 — CID 91054825
8-bromo-7-(3-chloropropyl)-1,3-dipropylpurine-2,6-dione (PubChem CID 91054825) has the molecular formula C14H20BrClN4O2 and a molecular weight of 391.70 g/mol. Its IUPAC name is 8-bromo-7-(3-chloropropyl)-1,3-dipropylpurine-2,6-dione.
| Compound Name | 8-bromo-7-(3-chloropropyl)-1,3-dipropylpurine-2,6-dione |
|---|---|
| PubChem CID | 91054825 |
| Molecular Formula | C14H20BrClN4O2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 8-bromo-7-(3-chloropropyl)-1,3-dipropylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Br)n2CCCCl)n(CCC)c1=O |
| InChI | InChI=1S/C14H20BrClN4O2/c1-3-7-19-11-10(12(21)20(8-4-2)14(19)22)18(9-5-6-16)13(15)17-11/h3-9H2,1-2H3 |
| InChIKey | JGMJZPPLIFEVRU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|