C12H19N5O2 — CID 82464656
7-ethyl-1-methyl-8-(methylamino)-3-propylpurine-2,6-dione (PubChem CID 82464656) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 7-ethyl-1-methyl-8-(methylamino)-3-propylpurine-2,6-dione.
| Compound Name | 7-ethyl-1-methyl-8-(methylamino)-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464656 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 7-ethyl-1-methyl-8-(methylamino)-3-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)n(C)c(=O)c2c1nc(NC)n2CC |
| InChI | InChI=1S/C12H19N5O2/c1-5-7-17-9-8(10(18)15(4)12(17)19)16(6-2)11(13-3)14-9/h5-7H2,1-4H3,(H,13,14) |
| InChIKey | KBEKGIAXKQNNFO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |