C13H17N5O2 — CID 118467472
1,3-dimethyl-8-[1-(prop-2-enylamino)prop-2-enyl]-7H-purine-2,6-dione (PubChem CID 118467472) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1,3-dimethyl-8-[1-(prop-2-enylamino)prop-2-enyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[1-(prop-2-enylamino)prop-2-enyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 118467472 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1,3-dimethyl-8-[1-(prop-2-enylamino)prop-2-enyl]-7H-purine-2,6-dione |
| SMILES | C=CCNC(C=C)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H17N5O2/c1-5-7-14-8(6-2)10-15-9-11(16-10)17(3)13(20)18(4)12(9)19/h5-6,8,14H,1-2,7H2,3-4H3,(H,15,16) |
| InChIKey | KXKQNNGRQMYLSC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|