C9H10N4O3S — CID 3553591
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetaldehyde (PubChem CID 3553591) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetaldehyde.
| Compound Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetaldehyde |
|---|---|
| PubChem CID | 3553591 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetaldehyde |
| SMILES | Cn1c(=O)c2[nH]c(SCC=O)nc2n(C)c1=O |
| InChI | InChI=1S/C9H10N4O3S/c1-12-6-5(7(15)13(2)9(12)16)10-8(11-6)17-4-3-14/h3H,4H2,1-2H3,(H,10,11) |
| InChIKey | UINPTYYREPNLPD-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|