C26H26N6O4S — CID 155813296
N-[4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]phenyl]-2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetamide (PubChem CID 155813296) has the molecular formula C26H26N6O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is N-[4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]phenyl]-2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]phenyl]-2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 155813296 |
| Molecular Formula | C26H26N6O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]phenyl]-2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2ccc(NC(=O)CSc3nc4c([nH]3)c(=O)n(C)c(=O)n4C)cc2)cc1 |
| InChI | InChI=1S/C26H26N6O4S/c1-30(2)19-12-5-16(6-13-19)7-14-20(33)17-8-10-18(11-9-17)27-21(34)15-37-25-28-22-23(29-25)31(3)26(36)32(4)24(22)35/h5-14H,15H2,1-4H3,(H,27,34)(H,28,29)/b14-7+ |
| InChIKey | KIHGTIZYCZXBQH-VGOFMYFVSA-N |
| XLogP | 2.65 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|