C12H9BrFN5O — CID 166385224
2-amino-8-(5-bromo-2-fluorophenyl)-1-methyl-7H-purin-6-one (PubChem CID 166385224) has the molecular formula C12H9BrFN5O and a molecular weight of 338.14 g/mol. Its IUPAC name is 2-amino-8-(5-bromo-2-fluorophenyl)-1-methyl-7H-purin-6-one.
| Compound Name | 2-amino-8-(5-bromo-2-fluorophenyl)-1-methyl-7H-purin-6-one |
|---|---|
| PubChem CID | 166385224 |
| Molecular Formula | C12H9BrFN5O |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-amino-8-(5-bromo-2-fluorophenyl)-1-methyl-7H-purin-6-one |
| SMILES | Cn1c(N)nc2nc(-c3cc(Br)ccc3F)[nH]c2c1=O |
| InChI | InChI=1S/C12H9BrFN5O/c1-19-11(20)8-10(18-12(19)15)17-9(16-8)6-4-5(13)2-3-7(6)14/h2-4H,1H3,(H2,15,18)(H,16,17) |
| InChIKey | ZVRCQIKOKHSWJD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |