C16H22ClN5O3 — CID 51139859
2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-cycloheptylacetamide (PubChem CID 51139859) has the molecular formula C16H22ClN5O3 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-cycloheptylacetamide.
| Compound Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 51139859 |
| Molecular Formula | C16H22ClN5O3 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-cycloheptylacetamide |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2CC(=O)NC2CCCCCC2)n(C)c1=O |
| InChI | InChI=1S/C16H22ClN5O3/c1-20-13-12(14(24)21(2)16(20)25)22(15(17)19-13)9-11(23)18-10-7-5-3-4-6-8-10/h10H,3-9H2,1-2H3,(H,18,23) |
| InChIKey | VVWBISPMJZLYKS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |