C14H20ClN5O3 — CID 8017982
2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-pentan-3-ylacetamide (PubChem CID 8017982) has the molecular formula C14H20ClN5O3 and a molecular weight of 341.80 g/mol. Its IUPAC name is 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-pentan-3-ylacetamide.
| Compound Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 8017982 |
| Molecular Formula | C14H20ClN5O3 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)Cn1c(Cl)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H20ClN5O3/c1-5-8(6-2)16-9(21)7-20-10-11(17-13(20)15)18(3)14(23)19(4)12(10)22/h8H,5-7H2,1-4H3,(H,16,21) |
| InChIKey | IFMNTYALTOGADM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |