C19H22ClN5O3 — CID 8018118
N-(4-butylphenyl)-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 8018118) has the molecular formula C19H22ClN5O3 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 8018118 |
| Molecular Formula | C19H22ClN5O3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(4-butylphenyl)-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)Cn2c(Cl)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C19H22ClN5O3/c1-4-5-6-12-7-9-13(10-8-12)21-14(26)11-25-15-16(22-18(25)20)23(2)19(28)24(3)17(15)27/h7-10H,4-6,11H2,1-3H3,(H,21,26) |
| InChIKey | GESXMIUVGFMVLB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |