C29H35N7O2S — CID 17072379
4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(4-butylphenyl)piperazine-1-carbothioamide (PubChem CID 17072379) has the molecular formula C29H35N7O2S and a molecular weight of 545.71 g/mol. Its IUPAC name is 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(4-butylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(4-butylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072379 |
| Molecular Formula | C29H35N7O2S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(4-butylphenyl)piperazine-1-carbothioamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCN(c3nc4c(c(=O)n(C)c(=O)n4C)n3Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H35N7O2S/c1-4-5-9-21-12-14-23(15-13-21)30-28(39)35-18-16-34(17-19-35)27-31-25-24(26(37)33(3)29(38)32(25)2)36(27)20-22-10-7-6-8-11-22/h6-8,10-15H,4-5,9,16-20H2,1-3H3,(H,30,39) |
| InChIKey | TXYPLVBQTQXZCA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|