C25H26BrN7O2S — CID 17072314
4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-phenylpiperazine-1-carbothioamide (PubChem CID 17072314) has the molecular formula C25H26BrN7O2S and a molecular weight of 568.50 g/mol. Its IUPAC name is 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-phenylpiperazine-1-carbothioamide.
| Compound Name | 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072314 |
| Molecular Formula | C25H26BrN7O2S |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-phenylpiperazine-1-carbothioamide |
| SMILES | Cn1c(=O)c2c(nc(N3CCN(C(=S)Nc4ccccc4)CC3)n2Cc2ccc(Br)cc2)n(C)c1=O |
| InChI | InChI=1S/C25H26BrN7O2S/c1-29-21-20(22(34)30(2)25(29)35)33(16-17-8-10-18(26)11-9-17)23(28-21)31-12-14-32(15-13-31)24(36)27-19-6-4-3-5-7-19/h3-11H,12-16H2,1-2H3,(H,27,36) |
| InChIKey | IOTWZXYACUVVKG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|