C22H28BrN7O3S — CID 17072324
4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 17072324) has the molecular formula C22H28BrN7O3S and a molecular weight of 550.48 g/mol. Its IUPAC name is 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072324 |
| Molecular Formula | C22H28BrN7O3S |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 4-[7-[(4-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(c2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H28BrN7O3S/c1-26-18-17(19(31)27(2)22(26)32)30(14-15-4-6-16(23)7-5-15)20(25-18)28-9-11-29(12-10-28)21(34)24-8-13-33-3/h4-7H,8-14H2,1-3H3,(H,24,34) |
| InChIKey | DUQVSDZFVFLBMF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|