C27H30ClN7O2S — CID 17072166
4-[7-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2,3-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 17072166) has the molecular formula C27H30ClN7O2S and a molecular weight of 552.10 g/mol. Its IUPAC name is 4-[7-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2,3-dimethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[7-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2,3-dimethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072166 |
| Molecular Formula | C27H30ClN7O2S |
| Molecular Weight | 552.10 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-[7-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]-N-(2,3-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCN(c3nc4c(c(=O)n(C)c(=O)n4C)n3Cc3ccc(Cl)cc3)CC2)c1C |
| InChI | InChI=1S/C27H30ClN7O2S/c1-17-6-5-7-21(18(17)2)29-26(38)34-14-12-33(13-15-34)25-30-23-22(24(36)32(4)27(37)31(23)3)35(25)16-19-8-10-20(28)11-9-19/h5-11H,12-16H2,1-4H3,(H,29,38) |
| InChIKey | MRFOYVMSGLMDQM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.10 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|