C23H29N7O2S — CID 17071947
N-cyclopropyl-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide (PubChem CID 17071947) has the molecular formula C23H29N7O2S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-cyclopropyl-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide.
| Compound Name | N-cyclopropyl-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17071947 |
| Molecular Formula | C23H29N7O2S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-cyclopropyl-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
| SMILES | Cc1cccc(Cn2c(N3CCN(C(=S)NC4CC4)CC3)nc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C23H29N7O2S/c1-15-5-4-6-16(13-15)14-30-18-19(26(2)23(32)27(3)20(18)31)25-21(30)28-9-11-29(12-10-28)22(33)24-17-7-8-17/h4-6,13,17H,7-12,14H2,1-3H3,(H,24,33) |
| InChIKey | FLYDWDZXZKQFES-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|