C26H27Cl2N7O2S — CID 17071943
N-(2,4-dichlorophenyl)-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide (PubChem CID 17071943) has the molecular formula C26H27Cl2N7O2S and a molecular weight of 572.52 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17071943 |
| Molecular Formula | C26H27Cl2N7O2S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[1,3-dimethyl-7-[(3-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
| SMILES | Cc1cccc(Cn2c(N3CCN(C(=S)Nc4ccc(Cl)cc4Cl)CC3)nc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C26H27Cl2N7O2S/c1-16-5-4-6-17(13-16)15-35-21-22(31(2)26(37)32(3)23(21)36)30-24(35)33-9-11-34(12-10-33)25(38)29-20-8-7-18(27)14-19(20)28/h4-8,13-14H,9-12,15H2,1-3H3,(H,29,38) |
| InChIKey | ZQTHGVCGWVCCFN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|