C27H31N7O4S — CID 17072376
4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 17072376) has the molecular formula C27H31N7O4S and a molecular weight of 549.66 g/mol. Its IUPAC name is 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072376 |
| Molecular Formula | C27H31N7O4S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(c3nc4c(c(=O)n(C)c(=O)n4C)n3Cc3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H31N7O4S/c1-30-23-22(24(35)31(2)27(30)36)34(17-18-8-6-5-7-9-18)25(29-23)32-12-14-33(15-13-32)26(39)28-20-11-10-19(37-3)16-21(20)38-4/h5-11,16H,12-15,17H2,1-4H3,(H,28,39) |
| InChIKey | YHZOBRYUKUBJGE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|