C28H33N7O4S — CID 17072008
N-(3,5-dimethoxyphenyl)-4-[1,3-dimethyl-7-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide (PubChem CID 17072008) has the molecular formula C28H33N7O4S and a molecular weight of 563.68 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-[1,3-dimethyl-7-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-[1,3-dimethyl-7-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17072008 |
| Molecular Formula | C28H33N7O4S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-[1,3-dimethyl-7-[(4-methylphenyl)methyl]-2,6-dioxopurin-8-yl]piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(c3nc4c(c(=O)n(C)c(=O)n4C)n3Cc3ccc(C)cc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C28H33N7O4S/c1-18-6-8-19(9-7-18)17-35-23-24(31(2)28(37)32(3)25(23)36)30-26(35)33-10-12-34(13-11-33)27(40)29-20-14-21(38-4)16-22(15-20)39-5/h6-9,14-16H,10-13,17H2,1-5H3,(H,29,40) |
| InChIKey | QTYWGHRHKUFMJP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|