C21H28FN3O3 — CID 170781317
tert-butyl N-[3-(7-carbamoyl-3-fluoro-2-methyl-1H-indol-4-yl)cyclohexyl]carbamate (PubChem CID 170781317) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl N-[3-(7-carbamoyl-3-fluoro-2-methyl-1H-indol-4-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(7-carbamoyl-3-fluoro-2-methyl-1H-indol-4-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170781317 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl N-[3-(7-carbamoyl-3-fluoro-2-methyl-1H-indol-4-yl)cyclohexyl]carbamate |
| SMILES | Cc1[nH]c2c(C(N)=O)ccc(C3CCCC(NC(=O)OC(C)(C)C)C3)c2c1F |
| InChI | InChI=1S/C21H28FN3O3/c1-11-17(22)16-14(8-9-15(19(23)26)18(16)24-11)12-6-5-7-13(10-12)25-20(27)28-21(2,3)4/h8-9,12-13,24H,5-7,10H2,1-4H3,(H2,23,26)(H,25,27) |
| InChIKey | ZCHWNHAYYAOWJE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |