C12H22N2O3 — CID 71279992
tert-butyl N-[(1R,3S)-3-carbamoylcyclohexyl]carbamate (PubChem CID 71279992) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-carbamoylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-carbamoylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 71279992 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-carbamoylcyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-12(2,3)17-11(16)14-9-6-4-5-8(7-9)10(13)15/h8-9H,4-7H2,1-3H3,(H2,13,15)(H,14,16)/t8-,9+/m0/s1 |
| InChIKey | GJQYLTXWWBVGLH-DTWKUNHWSA-N |
| XLogP | 1.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |