C12H12ClN3O — CID 135764107
2-[(2-chlorophenyl)methylamino]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135764107) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylamino]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2-chlorophenyl)methylamino]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135764107 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methylamino]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(NCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H12ClN3O/c1-8-6-11(17)16-12(15-8)14-7-9-4-2-3-5-10(9)13/h2-6H,7H2,1H3,(H2,14,15,16,17) |
| InChIKey | JZKYOBTWXBLCJX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |