C15H13ClN4O — CID 136808564
6-amino-2-[(2-chlorophenyl)methylamino]-3H-quinazolin-4-one (PubChem CID 136808564) has the molecular formula C15H13ClN4O and a molecular weight of 300.75 g/mol. Its IUPAC name is 6-amino-2-[(2-chlorophenyl)methylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[(2-chlorophenyl)methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136808564 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6-amino-2-[(2-chlorophenyl)methylamino]-3H-quinazolin-4-one |
| SMILES | Nc1ccc2nc(NCc3ccccc3Cl)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C15H13ClN4O/c16-12-4-2-1-3-9(12)8-18-15-19-13-6-5-10(17)7-11(13)14(21)20-15/h1-7H,8,17H2,(H2,18,19,20,21) |
| InChIKey | DQGHBAJDFGMBIC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|