C15H22N4O — CID 136809224
6-amino-2-(2,3,3-trimethylbutylamino)-3H-quinazolin-4-one (PubChem CID 136809224) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-amino-2-(2,3,3-trimethylbutylamino)-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-(2,3,3-trimethylbutylamino)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136809224 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 6-amino-2-(2,3,3-trimethylbutylamino)-3H-quinazolin-4-one |
| SMILES | CC(CNc1nc2ccc(N)cc2c(=O)[nH]1)C(C)(C)C |
| InChI | InChI=1S/C15H22N4O/c1-9(15(2,3)4)8-17-14-18-12-6-5-10(16)7-11(12)13(20)19-14/h5-7,9H,8,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | BLWPYQQLCSYCTN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|