C14H18BrN3O — CID 135439543
6-bromo-2-(3,3-dimethylbutan-2-ylamino)-3H-quinazolin-4-one (PubChem CID 135439543) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 6-bromo-2-(3,3-dimethylbutan-2-ylamino)-3H-quinazolin-4-one.
| Compound Name | 6-bromo-2-(3,3-dimethylbutan-2-ylamino)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135439543 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 6-bromo-2-(3,3-dimethylbutan-2-ylamino)-3H-quinazolin-4-one |
| SMILES | CC(Nc1nc2ccc(Br)cc2c(=O)[nH]1)C(C)(C)C |
| InChI | InChI=1S/C14H18BrN3O/c1-8(14(2,3)4)16-13-17-11-6-5-9(15)7-10(11)12(19)18-13/h5-8H,1-4H3,(H2,16,17,18,19) |
| InChIKey | OHIOETJPYSDLIR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |