C13H17N5O2 — CID 136784827
2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-3-methylbutanamide (PubChem CID 136784827) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 136784827 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1nc2ccc(N)cc2c(=O)[nH]1)C(N)=O |
| InChI | InChI=1S/C13H17N5O2/c1-6(2)10(11(15)19)17-13-16-9-4-3-7(14)5-8(9)12(20)18-13/h3-6,10H,14H2,1-2H3,(H2,15,19)(H2,16,17,18,20) |
| InChIKey | YIJLPOLSUZYCCV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|