C10H13N5O — CID 136809214
6-amino-2-(2,2-dimethylhydrazinyl)-3H-quinazolin-4-one (PubChem CID 136809214) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-amino-2-(2,2-dimethylhydrazinyl)-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-(2,2-dimethylhydrazinyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136809214 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-amino-2-(2,2-dimethylhydrazinyl)-3H-quinazolin-4-one |
| SMILES | CN(C)Nc1nc2ccc(N)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N5O/c1-15(2)14-10-12-8-4-3-6(11)5-7(8)9(16)13-10/h3-5H,11H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | BHEJHXLFDVDYDD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|