C12H17N5O3S — CID 136757554
2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-N,N-dimethylethanesulfonamide (PubChem CID 136757554) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 136757554 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[(6-amino-4-oxo-3H-quinazolin-2-yl)amino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNc1nc2ccc(N)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O3S/c1-17(2)21(19,20)6-5-14-12-15-10-4-3-8(13)7-9(10)11(18)16-12/h3-4,7H,5-6,13H2,1-2H3,(H2,14,15,16,18) |
| InChIKey | FWCARZMQQJUWGK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|