C12H14F2N4O2 — CID 136852738
6-amino-2-[2-(2,2-difluoroethoxy)ethylamino]-3H-quinazolin-4-one (PubChem CID 136852738) has the molecular formula C12H14F2N4O2 and a molecular weight of 284.27 g/mol. Its IUPAC name is 6-amino-2-[2-(2,2-difluoroethoxy)ethylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[2-(2,2-difluoroethoxy)ethylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136852738 |
| Molecular Formula | C12H14F2N4O2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-amino-2-[2-(2,2-difluoroethoxy)ethylamino]-3H-quinazolin-4-one |
| SMILES | Nc1ccc2nc(NCCOCC(F)F)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C12H14F2N4O2/c13-10(14)6-20-4-3-16-12-17-9-2-1-7(15)5-8(9)11(19)18-12/h1-2,5,10H,3-4,6,15H2,(H2,16,17,18,19) |
| InChIKey | VQIKMUFQEKLOHA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|