C14H20N4O — CID 136808941
6-amino-2-(hexan-3-ylamino)-3H-quinazolin-4-one (PubChem CID 136808941) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-amino-2-(hexan-3-ylamino)-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-(hexan-3-ylamino)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136808941 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 6-amino-2-(hexan-3-ylamino)-3H-quinazolin-4-one |
| SMILES | CCCC(CC)Nc1nc2ccc(N)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H20N4O/c1-3-5-10(4-2)16-14-17-12-7-6-9(15)8-11(12)13(19)18-14/h6-8,10H,3-5,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | AOEKCLQJUPTNCC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|