C14H13ClN4OS — CID 136808817
6-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]-3H-quinazolin-4-one (PubChem CID 136808817) has the molecular formula C14H13ClN4OS and a molecular weight of 320.81 g/mol. Its IUPAC name is 6-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136808817 |
| Molecular Formula | C14H13ClN4OS |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]-3H-quinazolin-4-one |
| SMILES | CC(Nc1nc2ccc(N)cc2c(=O)[nH]1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H13ClN4OS/c1-7(11-4-5-12(15)21-11)17-14-18-10-3-2-8(16)6-9(10)13(20)19-14/h2-7H,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | NWWLSOBPUYNBEH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|