C25H30N6O6 — CID 4254265
8-[4-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-4-oxobutyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 4254265) has the molecular formula C25H30N6O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 8-[4-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-4-oxobutyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[4-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-4-oxobutyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 4254265 |
| Molecular Formula | C25H30N6O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 8-[4-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-4-oxobutyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=O)CCCc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C25H30N6O6/c1-28-23-22(24(34)29(2)25(28)35)26-19(27-23)7-5-8-20(32)30-13-6-14-31(30)21(33)12-9-16-15-17(36-3)10-11-18(16)37-4/h9-12,15H,5-8,13-14H2,1-4H3,(H,26,27) |
| InChIKey | CHJNZTGLQBKMCC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|