C20H23N3O5 — CID 3813705
3-(2,5-dimethoxyphenyl)-1-[2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one (PubChem CID 3813705) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-[2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-[2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3813705 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-[2-(3,5-dimethyl-1,2-oxazole-4-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=O)c2c(C)noc2C)c1 |
| InChI | InChI=1S/C20H23N3O5/c1-13-19(14(2)28-21-13)20(25)23-11-5-10-22(23)18(24)9-6-15-12-16(26-3)7-8-17(15)27-4/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | LYTQOPXXFFZRIL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|