C20H21ClN2O6S2 — CID 3816010
1-[2-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)pyrazolidin-1-yl]-3-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 3816010) has the molecular formula C20H21ClN2O6S2 and a molecular weight of 484.98 g/mol. Its IUPAC name is 1-[2-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)pyrazolidin-1-yl]-3-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[2-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)pyrazolidin-1-yl]-3-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3816010 |
| Molecular Formula | C20H21ClN2O6S2 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 1-[2-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)pyrazolidin-1-yl]-3-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=O)c2scc(S(C)(=O)=O)c2Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O6S2/c1-28-14-6-7-15(29-2)13(11-14)5-8-17(24)22-9-4-10-23(22)20(25)19-18(21)16(12-30-19)31(3,26)27/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | LNEOWDYJNPCLIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|