C20H23N5O6 — CID 74227872
(E)-3-(2,5-dimethoxyphenyl)-1-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one (PubChem CID 74227872) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-1-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-1-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 74227872 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-1-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)N2CCCN2C(=O)c2c([N+](=O)[O-])c(C)nn2C)c1 |
| InChI | InChI=1S/C20H23N5O6/c1-13-18(25(28)29)19(22(2)21-13)20(27)24-11-5-10-23(24)17(26)9-6-14-12-15(30-3)7-8-16(14)31-4/h6-9,12H,5,10-11H2,1-4H3/b9-6+ |
| InChIKey | ANHSLVATINOYOW-RMKNXTFCSA-N |
| XLogP | 1.96 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|