C24H27N3O5 — CID 3496994
N-[2-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-2-oxoethyl]-3-methylbenzamide (PubChem CID 3496994) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[2-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | N-[2-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3496994 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[2-[2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=O)CNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H27N3O5/c1-17-6-4-7-19(14-17)24(30)25-16-23(29)27-13-5-12-26(27)22(28)11-8-18-15-20(31-2)9-10-21(18)32-3/h4,6-11,14-15H,5,12-13,16H2,1-3H3,(H,25,30) |
| InChIKey | WUOGIYDSHKYMRO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|