C21H30N4O4S — CID 3752895
2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide (PubChem CID 3752895) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide.
| Compound Name | 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3752895 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=S)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H30N4O4S/c1-27-18-5-6-19(28-2)17(16-18)4-7-20(26)24-9-3-10-25(24)21(30)22-8-11-23-12-14-29-15-13-23/h4-7,16H,3,8-15H2,1-2H3,(H,22,30) |
| InChIKey | UKUSIPDUCWGUFX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|