C17H24N2O4 — CID 36842232
(E)-3-(3,5-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 36842232) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 36842232 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCN2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-21-15-11-14(12-16(13-15)22-2)3-4-17(20)18-5-6-19-7-9-23-10-8-19/h3-4,11-13H,5-10H2,1-2H3,(H,18,20)/b4-3+ |
| InChIKey | QBVWCEDWJUCTKI-ONEGZZNKSA-N |
| XLogP | 1.17 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|