C24H31N3O5 — CID 69173856
1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 69173856) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 69173856 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | COc1cc(/C=C/c2ccc(OC)c(NC(=O)NCCN3CCOCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H31N3O5/c1-29-20-14-19(15-21(17-20)30-2)5-4-18-6-7-23(31-3)22(16-18)26-24(28)25-8-9-27-10-12-32-13-11-27/h4-7,14-17H,8-13H2,1-3H3,(H2,25,26,28)/b5-4+ |
| InChIKey | ROFRBHINSJODGW-SNAWJCMRSA-N |
| XLogP | 3.34 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|