About 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea
1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 69173856) has the molecular formula C24H31N3O5
and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea.
Molecular Properties
| Compound Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea |
| PubChem CID | 69173856 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | COc1cc(/C=C/c2ccc(OC)c(NC(=O)NCCN3CCOCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H31N3O5/c1-29-20-14-19(15-21(17-20)30-2)5-4-18-6-7-23(31-3)22(16-18)26-24(28)25-8-9-27-10-12-32-13-11-27/h4-7,14-17H,8-13H2,1-3H3,(H2,25,26,28)/b5-4+ |
| InChIKey | ROFRBHINSJODGW-SNAWJCMRSA-N |
| XLogP | 3.34 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea?
The IUPAC name of 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea (CID 69173856) is 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea.
What is the SMILES notation for 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea?
The canonical SMILES for 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea is COc1cc(/C=C/c2ccc(OC)c(NC(=O)NCCN3CCOCC3)c2)cc(OC)c1.
What is the InChIKey of 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea?
The InChIKey is ROFRBHINSJODGW-SNAWJCMRSA-N. The full InChI is InChI=1S/C24H31N3O5/c1-29-20-14-19(15-21(17-20)30-2)5-4-18-6-7-23(31-3)22(16-18)26-24(28)25-8-9-27-10-12-32-13-11-27/h4-7,14-17H,8-13H2,1-3H3,(H2,25,26,28)/b5-4+.
What are the key properties of 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea?
1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea has a molecular weight of 441.53 g/mol, XLogP of 3.34, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl]-3-(2-morpholin-4-ylethyl)urea is sourced from PubChem (CID 69173856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).