C16H20N2O5 — CID 3726048
methyl 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidine-1-carboxylate (PubChem CID 3726048) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidine-1-carboxylate.
| Compound Name | methyl 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 3726048 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 2-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]pyrazolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCN1C(=O)C=Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H20N2O5/c1-21-13-6-7-14(22-2)12(11-13)5-8-15(19)17-9-4-10-18(17)16(20)23-3/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | IJMBMLNZUARLOO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|