C21H23N3O4 — CID 3776328
3-(2,5-dimethoxyphenyl)-1-[2-(6-methylpyridine-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one (PubChem CID 3776328) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-[2-(6-methylpyridine-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-[2-(6-methylpyridine-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3776328 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-[2-(6-methylpyridine-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C=CC(=O)N2CCCN2C(=O)c2cccc(C)n2)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-15-6-4-7-18(22-15)21(26)24-13-5-12-23(24)20(25)11-8-16-14-17(27-2)9-10-19(16)28-3/h4,6-11,14H,5,12-13H2,1-3H3 |
| InChIKey | HRRXXJCUXKZJTO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|