C12H16N4O2 — CID 118982062
1,3-dimethyl-8-(3-methylbut-2-enyl)-7H-purine-2,6-dione (PubChem CID 118982062) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1,3-dimethyl-8-(3-methylbut-2-enyl)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(3-methylbut-2-enyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 118982062 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1,3-dimethyl-8-(3-methylbut-2-enyl)-7H-purine-2,6-dione |
| SMILES | CC(C)=CCc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H16N4O2/c1-7(2)5-6-8-13-9-10(14-8)15(3)12(18)16(4)11(9)17/h5H,6H2,1-4H3,(H,13,14) |
| InChIKey | YSHBCHKKOZQTHQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|