C11H14N4O4 — CID 88738024
8-(dioxolan-3-ylmethyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 88738024) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 8-(dioxolan-3-ylmethyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(dioxolan-3-ylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 88738024 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 8-(dioxolan-3-ylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(CC3CCOO3)nc2n(C)c1=O |
| InChI | InChI=1S/C11H14N4O4/c1-14-9-8(10(16)15(2)11(14)17)12-7(13-9)5-6-3-4-18-19-6/h6H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | UMKMAHLZWFVUAH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|