C20H25N5O2 — CID 154797194
8-[(3-benzylpiperidin-1-yl)methyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 154797194) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 8-[(3-benzylpiperidin-1-yl)methyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(3-benzylpiperidin-1-yl)methyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 154797194 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 8-[(3-benzylpiperidin-1-yl)methyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(CN3CCCC(Cc4ccccc4)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C20H25N5O2/c1-23-18-17(19(26)24(2)20(23)27)21-16(22-18)13-25-10-6-9-15(12-25)11-14-7-4-3-5-8-14/h3-5,7-8,15H,6,9-13H2,1-2H3,(H,21,22) |
| InChIKey | NNLVMJGLQUPFFL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |