C18H23N6O2+ — CID 6965340
1,3-dimethyl-8-[(4-phenylpiperazin-1-ium-1-yl)methyl]-7H-purine-2,6-dione (PubChem CID 6965340) has the molecular formula C18H23N6O2+ and a molecular weight of 355.42 g/mol. Its IUPAC name is 1,3-dimethyl-8-[(4-phenylpiperazin-1-ium-1-yl)methyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[(4-phenylpiperazin-1-ium-1-yl)methyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 6965340 |
| Molecular Formula | C18H23N6O2+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1,3-dimethyl-8-[(4-phenylpiperazin-1-ium-1-yl)methyl]-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C[NH+]3CCN(c4ccccc4)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C18H22N6O2/c1-21-16-15(17(25)22(2)18(21)26)19-14(20-16)12-23-8-10-24(11-9-23)13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3,(H,19,20)/p+1 |
| InChIKey | JLTUKUJXGCUQBI-UHFFFAOYSA-O |
| XLogP | -1.13 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |