C13H13N5O4 — CID 91947970
N-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]furan-2-carboxamide (PubChem CID 91947970) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91947970 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]furan-2-carboxamide |
| SMILES | Cn1c(=O)c2[nH]c(CNC(=O)c3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H13N5O4/c1-17-10-9(12(20)18(2)13(17)21)15-8(16-10)6-14-11(19)7-4-3-5-22-7/h3-5H,6H2,1-2H3,(H,14,19)(H,15,16) |
| InChIKey | UGYBRXAZKZSZFD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |