C20H19N5O5 — CID 91948144
N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-2-oxochromene-3-carboxamide (PubChem CID 91948144) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 91948144 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-2-oxochromene-3-carboxamide |
| SMILES | Cn1c(=O)c2[nH]c(CCCNC(=O)c3cc4ccccc4oc3=O)nc2n(C)c1=O |
| InChI | InChI=1S/C20H19N5O5/c1-24-16-15(18(27)25(2)20(24)29)22-14(23-16)8-5-9-21-17(26)12-10-11-6-3-4-7-13(11)30-19(12)28/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,21,26)(H,22,23) |
| InChIKey | WUUAUJYCANHPQO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|