C16H14N4O5 — CID 2145339
N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-oxochromene-3-carbohydrazide (PubChem CID 2145339) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 2145339 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-oxochromene-3-carbohydrazide |
| SMILES | Cn1c(NNC(=O)c2cc3ccccc3oc2=O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C16H14N4O5/c1-19-12(8-13(21)20(2)16(19)24)17-18-14(22)10-7-9-5-3-4-6-11(9)25-15(10)23/h3-8,17H,1-2H3,(H,18,22) |
| InChIKey | IZZFEJZMIRGZFL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|